![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 0601 - What is JSON-LD-poster.jpg | 2024-07-22 21:52 | 20K | |
| 0601 - What is JSON-LD.mp4 | 2024-06-05 00:26 | 7.5M | |
| 0602 - Implement predefined key names-poster.jpg | 2024-07-22 21:52 | 26K | |
| 0602 - Implement predefined key names.mp4 | 2024-06-05 00:26 | 24M | |
| 0603 - Map a data structure with JSON-LD-poster.jpg | 2024-07-22 21:52 | 33K | |
| 0603 - Map a data structure with JSON-LD.mp4 | 2024-06-05 00:26 | 11M | |
| 0604 - Work with JSON-LD generators-poster.jpg | 2024-07-22 21:52 | 21K | |
| 0604 - Work with JSON-LD generators.mp4 | 2024-06-05 00:26 | 12M | |
| 0605 - Add a JSON-LD snippet to a web page-poster.jpg | 2024-07-22 21:53 | 21K | |
| 0605 - Add a JSON-LD snippet to a web page.mp4 | 2024-06-05 00:26 | 8.0M | |
| 0606 - Challenge - Structure data with JSON-LD-poster.jpg | 2024-07-22 21:53 | 12K | |
| 0606 - Challenge - Structure data with JSON-LD.mp4 | 2024-06-05 00:26 | 5.4M | |
| 0607 - Solution Structure data with JSON-LD-poster.jpg | 2024-07-22 21:53 | 46K | |
| 0607 - Solution Structure data with JSON-LD.mp4 | 2024-06-05 00:26 | 27M | |