![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 0801 - Using advanced strokes-poster.jpg | 2024-07-22 22:02 | 93K | |
| 0801 - Using advanced strokes.mp4 | 2024-06-04 22:01 | 23M | |
| 0802 - Using Pathfinder and compound paths-poster.jpg | 2024-07-22 22:02 | 87K | |
| 0802 - Using Pathfinder and compound paths.mp4 | 2024-06-04 22:01 | 22M | |
| 0803 - Using InDesign and Illustrator together-poster.jpg | 2024-07-22 22:02 | 51K | |
| 0803 - Using InDesign and Illustrator together.mp4 | 2024-06-04 22:01 | 20M | |