![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 07 03. Calculating the number of days between events.mov | 2019-07-06 08:02 | 5.0M | |
| 07 03. Calculating the number of days between events.nfo | 2019-07-06 08:02 | 1.3K | |
| 07 02. Applying nominal versus effective interest rates (APR versus APY).mov | 2019-07-06 08:02 | 4.1M | |
| 07 02. Applying nominal versus effective interest rates (APR versus APY).nfo | 2019-07-06 08:02 | 1.4K | |
| 07 01. Calculating simple interest and compound interest.mov | 2019-07-06 08:02 | 4.3M | |
| 07 01. Calculating simple interest and compound interest.nfo | 2019-07-06 08:02 | 1.3K | |