![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 0501 Basic tag structure.mov | 2019-07-06 08:09 | 1.9M | |
| 0501 Basic tag structure.nfo | 2019-07-06 08:09 | 1.3K | |
| 0502 Adding structure to text.mov | 2019-07-06 08:09 | 11M | |
| 0502 Adding structure to text.nfo | 2019-07-06 08:09 | 1.3K | |
| 0503 Creating lists.mov | 2019-07-06 08:09 | 17M | |
| 0503 Creating lists.nfo | 2019-07-06 08:09 | 1.3K | |
| 0504 Getting text into Dreamweaver.mov | 2019-07-06 08:09 | 9.4M | |
| 0504 Getting text into Dreamweaver.nfo | 2019-07-06 08:09 | 1.3K | |
| 0505 Importing Word documents.mov | 2019-07-06 08:09 | 5.0M | |
| 0505 Importing Word documents.nfo | 2019-07-06 08:09 | 1.3K | |